Difference between revisions of "CPD-11712"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-Ser-or-Thr-phosphate == * common-name: ** a [protein] (l-serine/l-threonine) phosphate == Reaction(s) known to consume the compou...") |
(Created page with "Category:metabolite == Metabolite CPD-7279 == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o * inchi-key: ** ztalkmxohwqnia-t...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7279 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-cis,4-trans-xanthoxin |
+ | * smiles: | ||
+ | ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o | ||
+ | * inchi-key: | ||
+ | ** ztalkmxohwqnia-tvbshjcbsa-n | ||
+ | * molecular-weight: | ||
+ | ** 250.337 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.1.1.288-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-698]] |
+ | * [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-cis,4-trans-xanthoxin}} |
+ | {{#set: inchi-key=inchikey=ztalkmxohwqnia-tvbshjcbsa-n}} | ||
+ | {{#set: molecular-weight=250.337}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-7279
- common-name:
- 2-cis,4-trans-xanthoxin
- smiles:
- cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
- inchi-key:
- ztalkmxohwqnia-tvbshjcbsa-n
- molecular-weight:
- 250.337