Difference between revisions of "5Z-3-oxo-tetradec-5-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1108 == * common-name: ** β-d-ribofuranose * smiles: ** c(c1(c(o)c(o)c(o)o1))o * inchi-key: ** hmfhbzshggewlo-txicztdvsa-n * mo...")
(Created page with "Category:metabolite == Metabolite MYRICETIN == * common-name: ** myricetin * smiles: ** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3))) * inchi-key: ** ikmd...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1108 ==
+
== Metabolite MYRICETIN ==
 
* common-name:
 
* common-name:
** β-d-ribofuranose
+
** myricetin
 
* smiles:
 
* smiles:
** c(c1(c(o)c(o)c(o)o1))o
+
** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3)))
 
* inchi-key:
 
* inchi-key:
** hmfhbzshggewlo-txicztdvsa-n
+
** ikmdfbphznjcsn-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 150.131
+
** 317.231
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
+
* [[RXN-8450]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-ribofuranose}}
+
{{#set: common-name=myricetin}}
{{#set: inchi-key=inchikey=hmfhbzshggewlo-txicztdvsa-n}}
+
{{#set: inchi-key=inchikey=ikmdfbphznjcsn-uhfffaoysa-m}}
{{#set: molecular-weight=150.131}}
+
{{#set: molecular-weight=317.231}}

Revision as of 14:58, 5 January 2021

Metabolite MYRICETIN

  • common-name:
    • myricetin
  • smiles:
    • c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3)))
  • inchi-key:
    • ikmdfbphznjcsn-uhfffaoysa-m
  • molecular-weight:
    • 317.231

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality