Difference between revisions of "GLUTAMATE-1-SEMIALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite cis-D21-39-oxo-40-Me-C59-1-ACPs == * common-name: ** a cis-delta21-39-oxo-40-methyl-c59:1-[acp] == Reaction(s) known to consume the compo...") |
(Created page with "Category:metabolite == Metabolite UBIQUINONE-8 == * common-name: ** ubiquinone-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UBIQUINONE-8 == |
* common-name: | * common-name: | ||
− | ** | + | ** ubiquinone-8 |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o) | ||
+ | * inchi-key: | ||
+ | ** icfizjqgjajrsu-sghxuwjisa-n | ||
+ | * molecular-weight: | ||
+ | ** 727.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[R00281]] |
+ | * [[SUCDH_LPAREN_q8_RPAREN_m]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[R00281]] | ||
+ | * [[SUCDH_LPAREN_q8_RPAREN_m]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ubiquinone-8}} |
+ | {{#set: inchi-key=inchikey=icfizjqgjajrsu-sghxuwjisa-n}} | ||
+ | {{#set: molecular-weight=727.121}} |
Revision as of 14:59, 5 January 2021
Contents
Metabolite UBIQUINONE-8
- common-name:
- ubiquinone-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
- inchi-key:
- icfizjqgjajrsu-sghxuwjisa-n
- molecular-weight:
- 727.121