Difference between revisions of "Heparan-sulfate-D-GlcNS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10814 == * common-name: ** glycyl-l-proline * smiles: ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) * inchi-key: ** kznqnbzmbzjqjo-yfkpbyrvsa-n...") |
(Created page with "Category:metabolite == Metabolite Protein-L-Asparagine == * common-name: ** a [protein]-l-asparagine == Reaction(s) known to consume the compound == * 2.4.1.119-RXN *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Protein-L-Asparagine == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-l-asparagine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.4.1.119-RXN]] |
+ | * [[2.4.1.94-RXN]] | ||
+ | * [[RXN-16761]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.4.1.94-RXN]] | ||
+ | * [[RXN-16761]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-asparagine}} |
− | |||
− |
Revision as of 14:59, 5 January 2021
Contents
Metabolite Protein-L-Asparagine
- common-name:
- a [protein]-l-asparagine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-asparagine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.