Difference between revisions of "CPD-8093"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite 5-Dephospho-DNA == * common-name: ** a 5'-dephospho-[dna] == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-5-HYDROXYL-K...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-Dephospho-DNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5'-dephospho-[dna] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5'-dephospho-[dna]}} |
| − | |||
| − | |||
Revision as of 15:00, 5 January 2021
Contents
Metabolite 5-Dephospho-DNA
- common-name:
- a 5'-dephospho-[dna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-dephospho-[dna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
