Difference between revisions of "CPD-15016"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3943 == * common-name: ** (22α)-hydroxy-campesterol * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2c...")
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3943 ==
+
== Metabolite CPD-11407 ==
 
* common-name:
 
* common-name:
** (22α)-hydroxy-campesterol
+
** thyroxine sulfate
 
* smiles:
 
* smiles:
** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
+
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
 
* inchi-key:
 
* inchi-key:
** lszjaiforslkoy-pacuacimsa-n
+
** qyxijuzwssqict-lbprgkrzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 416.686
+
** 855.924
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4225]]
+
* [[RXN-10614]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(22α)-hydroxy-campesterol}}
+
{{#set: common-name=thyroxine sulfate}}
{{#set: inchi-key=inchikey=lszjaiforslkoy-pacuacimsa-n}}
+
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
{{#set: molecular-weight=416.686}}
+
{{#set: molecular-weight=855.924}}

Revision as of 15:00, 5 January 2021

Metabolite CPD-11407

  • common-name:
    • thyroxine sulfate
  • smiles:
    • c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
  • inchi-key:
    • qyxijuzwssqict-lbprgkrzsa-m
  • molecular-weight:
    • 855.924

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality