Difference between revisions of "SJ11118"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...") |
(Created page with "Category:gene == Gene SJ15636 == * transcription-direction: ** negative * right-end-position: ** 32618 * left-end-position: ** 27304 * centisome-position: ** 9.314447...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ15636 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 32618 |
− | * | + | * left-end-position: |
− | ** | + | ** 27304 |
− | * | + | * centisome-position: |
− | ** | + | ** 9.314447 |
− | == | + | == Organism(s) associated with this gene == |
− | + | * [[S.japonica_carotenoid_curated]] | |
− | * [[ | + | == Reaction(s) associated == |
− | * [[ | + | * [[PEROXID-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | + | * [[RXN-14240]] | |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[RXN-15288]] |
− | + | ** Category: [[annotation]] | |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[RXN-17352]] |
− | * [[ | + | ** Category: [[annotation]] |
− | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
− | * [[ | + | * [[RXN-8635]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | + | == Pathway(s) associated == | |
− | * [[ | + | * [[PWY-7214]] |
− | * [[ | + | ** '''1''' reactions found over '''2''' reactions in the full pathway |
− | * [[ | + | * [[PWY-7445]] |
− | + | ** '''1''' reactions found over '''4''' reactions in the full pathway | |
− | + | * [[PWY-5466]] | |
− | == | + | ** '''2''' reactions found over '''10''' reactions in the full pathway |
− | * [[ | + | * [[PWY-6824]] |
− | * [[ | + | ** '''2''' reactions found over '''10''' reactions in the full pathway |
− | * [[ | + | * [[PWY-5469]] |
− | * [[ | + | ** '''2''' reactions found over '''8''' reactions in the full pathway |
− | * | + | * [[PWY-5461]] |
− | * [[ | + | ** '''1''' reactions found over '''1''' reactions in the full pathway |
− | * | + | {{#set: transcription-direction=negative}} |
− | * [[ | + | {{#set: right-end-position=32618}} |
− | + | {{#set: left-end-position=27304}} | |
− | {{#set: | + | {{#set: centisome-position=9.314447 }} |
− | {{#set: | + | {{#set: organism associated=S.japonica_carotenoid_curated}} |
− | {{#set: | + | {{#set: nb reaction associated=5}} |
+ | {{#set: nb pathway associated=6}} |
Revision as of 15:24, 5 January 2021
Contents
Gene SJ15636
- transcription-direction:
- negative
- right-end-position:
- 32618
- left-end-position:
- 27304
- centisome-position:
- 9.314447
Organism(s) associated with this gene
Reaction(s) associated
- PEROXID-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-14240
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-15288
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-17352
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-8635
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-7214
- 1 reactions found over 2 reactions in the full pathway
- PWY-7445
- 1 reactions found over 4 reactions in the full pathway
- PWY-5466
- 2 reactions found over 10 reactions in the full pathway
- PWY-6824
- 2 reactions found over 10 reactions in the full pathway
- PWY-5469
- 2 reactions found over 8 reactions in the full pathway
- PWY-5461
- 1 reactions found over 1 reactions in the full pathway