Difference between revisions of "DIHYDRO-NEO-PTERIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FERULIC-ACID == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) * inchi-key: ** ksebmyqbyztdhs-hwkanzrosa-m * mo...") |
(Created page with "Category:metabolite == Metabolite Uridine32-in-tRNA == * common-name: ** a uridine32 in trna == Reaction(s) known to consume the compound == * RXN-11842 == Reaction(s)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Uridine32-in-tRNA == |
* common-name: | * common-name: | ||
− | ** | + | ** a uridine32 in trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-11842]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a uridine32 in trna}} |
− | |||
− |
Revision as of 15:24, 5 January 2021
Contents
Metabolite Uridine32-in-tRNA
- common-name:
- a uridine32 in trna