Difference between revisions of "Cyclic-Phosphate-Terminated-RNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine == * common-name: ** a [dna ligase]-l-lysine == Reaction(s) known to consume the compound == * RXN-17917 * RXN-...") |
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common-name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakd...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15318 == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-d-ribose 5-phosphate |
| + | * smiles: | ||
| + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) | ||
| + | * inchi-key: | ||
| + | ** ktvpxoyakdprhy-aihaylrmsa-l | ||
| + | * molecular-weight: | ||
| + | ** 228.095 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R5PDP]] |
| − | + | * [[RPDPK]] | |
| − | * [[ | + | * [[RXN-14456]] |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[ARDP]] |
| − | * [[RXN- | + | * [[RIBOKIN-RXN]] |
| + | * [[RPDPK]] | ||
| + | * [[RXN-14456]] | ||
| + | * [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-d-ribose 5-phosphate}} |
| + | {{#set: inchi-key=inchikey=ktvpxoyakdprhy-aihaylrmsa-l}} | ||
| + | {{#set: molecular-weight=228.095}} | ||
Revision as of 15:24, 5 January 2021
Contents
Metabolite CPD-15318
- common-name:
- α-d-ribose 5-phosphate
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
- inchi-key:
- ktvpxoyakdprhy-aihaylrmsa-l
- molecular-weight:
- 228.095
