Difference between revisions of "CPD-11526"

Revision as of 15:25, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-18447 ==
+== Metabolite L-PHOSPHATIDATE ==
 * common-name:
-** actinocin
+** a 1,2-diacyl-sn-glycerol 3-phosphate
-* smiles:
-** cc1(=cc=c(c(=o)[o-])c2(n=c3(c(oc1=2)=c(c)c(=o)c(n)=c(c(=o)[o-])3)))
-* inchi-key:
-** kxrmrepjuitwdu-uhfffaoysa-l
-* molecular-weight:
-** 326.265
 == Reaction(s) known to consume the compound ==
-* [[RXN-17077]]
+* [[CDPDIGLYSYN-RXN]]
+* [[PHOSPHATIDATE-PHOSPHATASE-RXN]]
+* [[RXN-16066]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17077]]
+* [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]]
+* [[DIACYLGLYKIN-RXN]]
+* [[PHOSCHOL-RXN]]
+* [[RXN-11277]]
+* [[RXN-12116]]
+* [[RXN-12959]]
+* [[RXN-16066]]
+* [[RXN-1623]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=actinocin}}
+{{#set: common-name=a 1,2-diacyl-sn-glycerol 3-phosphate}}
-{{#set: inchi-key=inchikey=kxrmrepjuitwdu-uhfffaoysa-l}}
-{{#set: molecular-weight=326.265}}