Difference between revisions of "Cytochrome-c-arginines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTADEC-9-ENE-118-DIOIC-ACID == * common-name: ** α,ω-9z-octadecenedioate * smiles: ** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite CPD3DJ-82 == * common-name: ** a dihydroceramide == Reaction(s) known to consume the compound == * RXN-7796 == Reaction(s) known to p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTADEC-9-ENE-118-DIOIC-ACID ==
+
== Metabolite CPD3DJ-82 ==
 
* common-name:
 
* common-name:
** α,ω-9z-octadecenedioate
+
** a dihydroceramide
* smiles:
 
** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]
 
* inchi-key:
 
** sblkviqsiheqof-uphrsurjsa-l
 
* molecular-weight:
 
** 310.433
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16418]]
+
* [[RXN-7796]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α,ω-9z-octadecenedioate}}
+
{{#set: common-name=a dihydroceramide}}
{{#set: inchi-key=inchikey=sblkviqsiheqof-uphrsurjsa-l}}
 
{{#set: molecular-weight=310.433}}
 

Revision as of 15:25, 5 January 2021

Metabolite CPD3DJ-82

  • common-name:
    • a dihydroceramide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality