Difference between revisions of "TRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DUMP == * common-name: ** dump * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** jsrljpsbldheio-shyzeuofs...")
(Created page with "Category:metabolite == Metabolite tRNAs == * common-name: ** an uncharged trna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DUMP ==
+
== Metabolite tRNAs ==
 
* common-name:
 
* common-name:
** dump
+
** an uncharged trna
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
** jsrljpsbldheio-shyzeuofsa-l
 
* molecular-weight:
 
** 306.168
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MDUMT]]
 
* [[RXN-14143]]
 
* [[THYMIDYLATESYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DCMP-DEAMINASE-RXN]]
+
* [[AMINOCYL-TRNA-HYDROLASE-RXN]]
* [[DUTNH]]
+
* [[RXN-15041]]
* [[DUTP-PYROP-RXN]]
+
* [[RXN0-6480]]
* [[MDUMT]]
 
* [[RXN-14199]]
 
* [[RXN-14220]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dump}}
+
{{#set: common-name=an uncharged trna}}
{{#set: inchi-key=inchikey=jsrljpsbldheio-shyzeuofsa-l}}
 
{{#set: molecular-weight=306.168}}
 

Revision as of 15:26, 5 January 2021

Metabolite tRNAs

  • common-name:
    • an uncharged trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality