Difference between revisions of "TRNA-uridine13"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16817 == * common-name: ** indoxyl sulfate * smiles: ** c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2)) * inchi-key: ** bxffhsidqofmle-uhfffa...") |
(Created page with "Category:metabolite == Metabolite CPD-4081 == * common-name: ** 4α-methyl-5α-ergosta-8,24-dien-3β-ol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-4081 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4α-methyl-5α-ergosta-8,24-dien-3β-ol |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)c(o)ccc(c)1c=2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qldnwjojcdimkk-xlfbywhpsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 412.698 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-4144]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4α-methyl-5α-ergosta-8,24-dien-3β-ol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qldnwjojcdimkk-xlfbywhpsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=412.698}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-4081
- common-name:
- 4α-methyl-5α-ergosta-8,24-dien-3β-ol
- smiles:
- cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)c(o)ccc(c)1c=2ccc(c)34))))
- inchi-key:
- qldnwjojcdimkk-xlfbywhpsa-n
- molecular-weight:
- 412.698