Difference between revisions of "THF"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-GLU == * common-name: ** n-acetyl-l-glutamate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** rfmmmvdnipukgg-yfkpbyrvs...")
(Created page with "Category:metabolite == Metabolite Pyruvate-dehydrogenase-lipoate == * common-name: ** a [pyruvate dehydrogenase e2 protein] n6-lipoyl-l-lysine == Reaction(s) known to cons...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETYL-GLU ==
+
== Metabolite Pyruvate-dehydrogenase-lipoate ==
 
* common-name:
 
* common-name:
** n-acetyl-l-glutamate
+
** a [pyruvate dehydrogenase e2 protein] n6-lipoyl-l-lysine
* smiles:
 
** cc(=o)nc(c([o-])=o)ccc(=o)[o-]
 
* inchi-key:
 
** rfmmmvdnipukgg-yfkpbyrvsa-l
 
* molecular-weight:
 
** 187.152
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[RXN-12508]]
* [[AGK]]
+
* [[RXN0-1134]]
* [[N-ACETYLTRANSFER-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[RXN-14957]]
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+
* [[RXN0-1132]]
* [[N-ACETYLTRANSFER-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-glutamate}}
+
{{#set: common-name=a [pyruvate dehydrogenase e2 protein] n6-lipoyl-l-lysine}}
{{#set: inchi-key=inchikey=rfmmmvdnipukgg-yfkpbyrvsa-l}}
 
{{#set: molecular-weight=187.152}}
 

Revision as of 15:26, 5 January 2021

Metabolite Pyruvate-dehydrogenase-lipoate

  • common-name:
    • a [pyruvate dehydrogenase e2 protein] n6-lipoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e2 protein] n6-lipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.