Difference between revisions of "CPD-1137"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-THREONINE-O-3-PHOSPHATE == * common-name: ** l-threonine 3-o-phosphate * smiles: ** cc(op([o-])([o-])=o)c([n+])c([o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite mRNA-Fragments == * common-name: ** an mrna fragment == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite mRNA-Fragments == |
* common-name: | * common-name: | ||
− | ** | + | ** an mrna fragment |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.1.26.3-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an mrna fragment}} |
− | |||
− |
Revision as of 15:26, 5 January 2021
Contents
Metabolite mRNA-Fragments
- common-name:
- an mrna fragment