Difference between revisions of "CPD1F-140"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-CARBOXYVINYL-CARBOXYPHOSPHONATE == * common-name: ** 1-carboxyvinyl carboxyphosphonate * smiles: ** c=c(c([o-])=o)op(=o)(c(=o)[o-])[o-]...")
(Created page with "Category:metabolite == Metabolite CPD-170 == * common-name: ** stachyose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-CARBOXYVINYL-CARBOXYPHOSPHONATE ==
+
== Metabolite CPD-170 ==
 
* common-name:
 
* common-name:
** 1-carboxyvinyl carboxyphosphonate
+
** stachyose
 
* smiles:
 
* smiles:
** c=c(c([o-])=o)op(=o)(c(=o)[o-])[o-]
+
** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
 
* inchi-key:
 
* inchi-key:
** lpufgtsgsicqbx-uhfffaoysa-k
+
** uqziybxshagnoe-xnsrjbnmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 193.029
+
** 666.583
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.8.23-RXN]]
+
* [[2.4.1.67-RXN]]
* [[RXN-10827]]
+
* [[RXN-11501]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.8.23-RXN]]
+
* [[2.4.1.67-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-carboxyvinyl carboxyphosphonate}}
+
{{#set: common-name=stachyose}}
{{#set: inchi-key=inchikey=lpufgtsgsicqbx-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=uqziybxshagnoe-xnsrjbnmsa-n}}
{{#set: molecular-weight=193.029}}
+
{{#set: molecular-weight=666.583}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-170

  • common-name:
    • stachyose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
  • inchi-key:
    • uqziybxshagnoe-xnsrjbnmsa-n
  • molecular-weight:
    • 666.583

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality