Difference between revisions of "CPD-17281"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-containing-a-Apyrimidinic-Sites == * common-name: ** an apyrimidinic site in dna == Reaction(s) known to consume the compound == == R...") |
(Created page with "Category:metabolite == Metabolite N1-METHYLADENINE == * common-name: ** n1-methyladenine * smiles: ** cn2(c=nc1(c(n=cn=1)=c(n)2)) * inchi-key: ** hpzmwtnatzpbih-uhfffaoysa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite N1-METHYLADENINE == |
* common-name: | * common-name: | ||
− | ** | + | ** n1-methyladenine |
+ | * smiles: | ||
+ | ** cn2(c=nc1(c(n=cn=1)=c(n)2)) | ||
+ | * inchi-key: | ||
+ | ** hpzmwtnatzpbih-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 149.155 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-984]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n1-methyladenine}} |
+ | {{#set: inchi-key=inchikey=hpzmwtnatzpbih-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=149.155}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite N1-METHYLADENINE
- common-name:
- n1-methyladenine
- smiles:
- cn2(c=nc1(c(n=cn=1)=c(n)2))
- inchi-key:
- hpzmwtnatzpbih-uhfffaoysa-n
- molecular-weight:
- 149.155