Difference between revisions of "BENZOYLCOA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Sphingoids == * common-name: ** a sphingoid base == Reaction(s) known to consume the compound == * RXN-11376 * SPHINGOSINE-N-ACYLTR...")
(Created page with "Category:metabolite == Metabolite CPD-9871 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Sphingoids ==
+
== Metabolite CPD-9871 ==
 
* common-name:
 
* common-name:
** a sphingoid base
+
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** xcoxsblqzpfvgk-rgiwonjesa-n
 +
* molecular-weight:
 +
** 835.347
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11376]]
 
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
+
* [[RXN-9235]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a sphingoid base}}
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
 +
{{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}}
 +
{{#set: molecular-weight=835.347}}

Revision as of 15:28, 5 January 2021

Metabolite CPD-9871

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • xcoxsblqzpfvgk-rgiwonjesa-n
  • molecular-weight:
    • 835.347

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality