Difference between revisions of "DIHYDROPTERIN-CH2OH-PP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14736 == * common-name: ** l-kynurenine * smiles: ** c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1) * inchi-key: ** ygpsjzoedvaxab-qmmmgpob...") |
(Created page with "Category:metabolite == Metabolite METHYLBUT-CPD == * common-name: ** 2-methylbutanal * smiles: ** ccc(c)[ch]=o * inchi-key: ** bygqbdhughbgmd-uhfffaoysa-n * molecular-weig...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD | + | == Metabolite METHYLBUT-CPD == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-methylbutanal |
* smiles: | * smiles: | ||
− | ** c | + | ** ccc(c)[ch]=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bygqbdhughbgmd-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 86.133 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7694]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-methylbutanal}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bygqbdhughbgmd-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=86.133}} |
Revision as of 15:28, 5 January 2021
Contents
Metabolite METHYLBUT-CPD
- common-name:
- 2-methylbutanal
- smiles:
- ccc(c)[ch]=o
- inchi-key:
- bygqbdhughbgmd-uhfffaoysa-n
- molecular-weight:
- 86.133