Difference between revisions of "DEHYDRO-DEOXY-GALACTONATE-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o...")
(Created page with "Category:metabolite == Metabolite CPD-7032 == * common-name: ** 3-methylbutanol * smiles: ** cc(cco)c * inchi-key: ** phtqwckdnzkarw-uhfffaoysa-n * molecular-weight: ** 88...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GERANYLGERANYL-PP ==
+
== Metabolite CPD-7032 ==
 
* common-name:
 
* common-name:
** geranylgeranyl diphosphate
+
** 3-methylbutanol
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+
** cc(cco)c
 
* inchi-key:
 
* inchi-key:
** oinneunvozhbox-qircyjposa-k
+
** phtqwckdnzkarw-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 447.424
+
** 88.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.32-RXN]]
+
* [[RXN-7693]]
* [[2.5.1.41-RXN]]
 
* [[2.5.1.42-RXN]]
 
* [[RXN-10625]]
 
* [[RXN-11486]]
 
* [[RXN-11488]]
 
* [[RXN-13323]]
 
* [[RXN-14929]]
 
* [[RXN-17480]]
 
* [[RXN-3701]]
 
* [[RXN-7658]]
 
* [[RXN-7663]]
 
* [[RXN-7673]]
 
* [[RXN-8788]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FARNESYLTRANSTRANSFERASE-RXN]]
+
* [[RXN-7693]]
* [[GGPS]]
 
* [[RXN-3701]]
 
* [[RXN-7658]]
 
* [[RXN-7673]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranylgeranyl diphosphate}}
+
{{#set: common-name=3-methylbutanol}}
{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
+
{{#set: inchi-key=inchikey=phtqwckdnzkarw-uhfffaoysa-n}}
{{#set: molecular-weight=447.424}}
+
{{#set: molecular-weight=88.149}}

Revision as of 15:28, 5 January 2021

Metabolite CPD-7032

  • common-name:
    • 3-methylbutanol
  • smiles:
    • cc(cco)c
  • inchi-key:
    • phtqwckdnzkarw-uhfffaoysa-n
  • molecular-weight:
    • 88.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality