Difference between revisions of "CPD-14053"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13390 == * common-name: ** l-methionyl-l-alanine dipeptide * smiles: ** cc(c(=o)[o-])nc(=o)c(ccsc)[n+] * inchi-key: ** jhkxzylnvjraaj...") |
(Created page with "Category:metabolite == Metabolite 11Z-3-oxo-icos-11-enoyl-ACPs == * common-name: ** an (11z)-3-oxo-icos-11-enoyl-[acp] == Reaction(s) known to consume the compound == * ...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 11Z-3-oxo-icos-11-enoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an (11z)-3-oxo-icos-11-enoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16630]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16629]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an (11z)-3-oxo-icos-11-enoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 15:29, 5 January 2021
Contents
Metabolite 11Z-3-oxo-icos-11-enoyl-ACPs
- common-name:
- an (11z)-3-oxo-icos-11-enoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an (11z)-3-oxo-icos-11-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
