Difference between revisions of "BETAINE ALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11403 == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite DELTA3-ISOPENTENYL-PP == * common-name: ** isopentenyl diphosphate * smiles: ** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-] * inchi-key: ** nuhs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11403 ==
+
== Metabolite DELTA3-ISOPENTENYL-PP ==
 
* common-name:
 
* common-name:
** tetraiodothyroacetate
+
** isopentenyl diphosphate
 
* smiles:
 
* smiles:
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
+
** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ppjyssnksxavdb-uhfffaoysa-m
+
** nuhsrofqtuxzqq-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
** 746.825
+
** 243.069
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10616]]
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
* [[RXN-10617]]
+
* [[FPPS]]
 +
* [[FPPSYN-RXN]]
 +
* [[GGPS]]
 +
* [[GPPS]]
 +
* [[GPPSYN-RXN]]
 +
* [[IDI]]
 +
* [[IPPISOM-RXN]]
 +
* [[RXN-10068]]
 +
* [[RXN-11486]]
 +
* [[RXN-11488]]
 +
* [[RXN-11963]]
 +
* [[RXN-8999]]
 +
* [[RXN-9969]]
 +
* [[RXN0-5180]]
 +
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 +
* [[GPPSYN-RXN]]
 +
* [[IDS1]]
 +
* [[IPPISOM-RXN]]
 +
* [[ISPH2-RXN]]
 +
* [[RXN-10068]]
 +
* [[RXN-11963]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetraiodothyroacetate}}
+
{{#set: common-name=isopentenyl diphosphate}}
{{#set: inchi-key=inchikey=ppjyssnksxavdb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}}
{{#set: molecular-weight=746.825}}
+
{{#set: molecular-weight=243.069}}

Revision as of 15:29, 5 January 2021

Metabolite DELTA3-ISOPENTENYL-PP

  • common-name:
    • isopentenyl diphosphate
  • smiles:
    • c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
  • inchi-key:
    • nuhsrofqtuxzqq-uhfffaoysa-k
  • molecular-weight:
    • 243.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality