Difference between revisions of "Charged-HIS-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3707 == * common-name: ** adenosine 2',3'-cyclic monophosphate * smiles: ** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n)...") |
(Created page with "Category:metabolite == Metabolite TAGATOSE-6-PHOSPHATE == * common-name: ** d-tagatofuranose 6-phosphate * smiles: ** c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o * inchi-key:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite TAGATOSE-6-PHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** d-tagatofuranose 6-phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bgwgxpapygqalx-oexcpvawsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 258.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[TAGAKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-tagatofuranose 6-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bgwgxpapygqalx-oexcpvawsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.121}} |
Revision as of 15:29, 5 January 2021
Contents
Metabolite TAGATOSE-6-PHOSPHATE
- common-name:
- d-tagatofuranose 6-phosphate
- smiles:
- c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o
- inchi-key:
- bgwgxpapygqalx-oexcpvawsa-l
- molecular-weight:
- 258.121