Difference between revisions of "23S-rRNA-5-methylcytosine1962"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16551 == * common-name: ** β-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakdp...") |
(Created page with "Category:metabolite == Metabolite PROPIONATE == * common-name: ** propanoate * smiles: ** ccc(=o)[o-] * inchi-key: ** xbdqkxxyiptubi-uhfffaoysa-m * molecular-weight: ** 73...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROPIONATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** propanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xbdqkxxyiptubi-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 73.071 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[23-DIMETHYLMALATE-LYASE-RXN]] |
| + | * [[RXN-14727]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=propanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xbdqkxxyiptubi-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=73.071}} |
Revision as of 15:29, 5 January 2021
Contents
Metabolite PROPIONATE
- common-name:
- propanoate
- smiles:
- ccc(=o)[o-]
- inchi-key:
- xbdqkxxyiptubi-uhfffaoysa-m
- molecular-weight:
- 73.071
