Difference between revisions of "Pyruvate-dehydrogenase-acetylDHlipoyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10608 == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgxazmfwnh-onegzznksa-m *...")
(Created page with "Category:metabolite == Metabolite MET == * common-name: ** l-methionine * smiles: ** csccc([n+])c([o-])=o * inchi-key: ** ffearjckvfrzrr-bypyzucnsa-n * molecular-weight: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10608 ==
+
== Metabolite MET ==
 
* common-name:
 
* common-name:
** trans-dienelactone
+
** l-methionine
 
* smiles:
 
* smiles:
** c1(=cc(=o)oc(=cc(=o)[o-])1)
+
** csccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** ayfxpgxazmfwnh-onegzznksa-m
+
** ffearjckvfrzrr-bypyzucnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 139.087
+
** 149.207
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9868]]
+
* [[HOMOCYSMET-RXN]]
 +
* [[METHIONINE--TRNA-LIGASE-RXN]]
 +
* [[RXN-14147]]
 +
* [[RXN-16165]]
 +
* [[RXN0-6948]]
 +
* [[S-ADENMETSYN-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.8.4.14-RXN]]
 +
* [[2.1.1.5-RXN]]
 +
* [[2.8.1.6-RXN]]
 +
* [[3.4.11.18-RXN]]
 +
* [[HEMN-RXN]]
 +
* [[HOMOCYSMET-RXN]]
 +
* [[HOMOCYSMETB12-RXN]]
 +
* [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]]
 +
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
 +
* [[MMUM-RXN]]
 +
* [[PYRIMSYN1-RXN]]
 +
* [[RXN-11319]]
 +
* [[RXN-11586]]
 +
* [[RXN-14147]]
 +
* [[RXN-14480]]
 +
* [[RXN-14950]]
 +
* [[RXN-14957]]
 +
* [[RXN-14959]]
 +
* [[RXN-17472]]
 +
* [[RXN-17473]]
 +
* [[RXN-17873]]
 +
* [[RXN-17874]]
 +
* [[RXN-17875]]
 +
* [[RXN-17876]]
 +
* [[RXN-17877]]
 +
* [[RXN-17878]]
 +
* [[RXN-8340]]
 +
* [[RXN0-5063]]
 +
* [[RXN0-6974]]
 +
* [[RXN0-6985]]
 +
* [[RXN0-949]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-dienelactone}}
+
{{#set: common-name=l-methionine}}
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}}
+
{{#set: inchi-key=inchikey=ffearjckvfrzrr-bypyzucnsa-n}}
{{#set: molecular-weight=139.087}}
+
{{#set: molecular-weight=149.207}}

Revision as of 15:29, 5 January 2021