Difference between revisions of "PYRIDOXAMINE-5P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite P3I == * common-name: ** pppi * smiles: ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o * inchi-key: ** unxrwkveancorm-uhfffaoysa-i * mole...") |
(Created page with "Category:metabolite == Metabolite CPD-9459 == * common-name: ** oleanolate * smiles: ** cc3(c[ch]4(c2(=cc[ch]5(c1(ccc(c([ch]1ccc(c2(ccc(cc3)4c([o-])=o)c)5c)(c)c)o)c))))c *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9459 == |
* common-name: | * common-name: | ||
| − | ** | + | ** oleanolate |
* smiles: | * smiles: | ||
| − | ** [ | + | ** cc3(c[ch]4(c2(=cc[ch]5(c1(ccc(c([ch]1ccc(c2(ccc(cc3)4c([o-])=o)c)5c)(c)c)o)c))))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mijyxulnpsfwek-gtofxwbisa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 455.699 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9000]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=oleanolate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mijyxulnpsfwek-gtofxwbisa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=455.699}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite CPD-9459
- common-name:
- oleanolate
- smiles:
- cc3(c[ch]4(c2(=cc[ch]5(c1(ccc(c([ch]1ccc(c2(ccc(cc3)4c([o-])=o)c)5c)(c)c)o)c))))c
- inchi-key:
- mijyxulnpsfwek-gtofxwbisa-m
- molecular-weight:
- 455.699
