Difference between revisions of "25S-rRNA-adenine-2142"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14875 == * common-name: ** grixazone b * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3))) * inchi...") |
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * smiles: ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) * inchi-key: *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite FMN == |
* common-name: | * common-name: | ||
− | ** | + | ** fmn |
* smiles: | * smiles: | ||
− | ** | + | ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ankzybdxhmzbdk-scrdcrapsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 453.324 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[FAD-PYROPHOSPHATASE-RXN]] | ||
+ | * [[FADSYN-RXN]] | ||
+ | * [[RXN-9510]] | ||
+ | * [[RXN0-5187]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ARPT]] |
+ | * [[FAD-PYROPHOSPHATASE-RXN]] | ||
+ | * [[RIBOFLAVINKIN-RXN]] | ||
+ | * [[RXN-9510]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=fmn}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=453.324}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite FMN
- common-name:
- fmn
- smiles:
- cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
- inchi-key:
- ankzybdxhmzbdk-scrdcrapsa-k
- molecular-weight:
- 453.324