Difference between revisions of "TRNA-Containing-N2-Methylgua-26-Gua27"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-PARATHION == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=cc(=cc=1)n))(occ)=s * inchi-key: ** xizotxgjxstqdi-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite tRNAPhe-wybutosine == * common-name: ** wybutosine37 in trnaphe == Reaction(s) known to consume the compound == == Reaction(s) known to p...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite tRNAPhe-wybutosine == |
* common-name: | * common-name: | ||
− | ** | + | ** wybutosine37 in trnaphe |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14520]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=wybutosine37 in trnaphe}} |
− | |||
− |
Revision as of 15:31, 5 January 2021
Contents
Metabolite tRNAPhe-wybutosine
- common-name:
- wybutosine37 in trnaphe