Difference between revisions of "DNA-containing-aPurinic-Sites"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SOLANESYL-PYROPHOSPHATE == * common-name: ** all-trans-nonaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...")
(Created page with "Category:metabolite == Metabolite Cleaved-Angiotensinogen == * common-name: ** a cleaved angiotensinogen == Reaction(s) known to consume the compound == == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SOLANESYL-PYROPHOSPHATE ==
+
== Metabolite Cleaved-Angiotensinogen ==
 
* common-name:
 
* common-name:
** all-trans-nonaprenyl diphosphate
+
** a cleaved angiotensinogen
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
* inchi-key:
 
** ivlbhbftrnviap-meggaxogsa-k
 
* molecular-weight:
 
** 788.015
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2761]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11486]]
+
* [[3.4.23.15-RXN]]
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-nonaprenyl diphosphate}}
+
{{#set: common-name=a cleaved angiotensinogen}}
{{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}}
 
{{#set: molecular-weight=788.015}}
 

Revision as of 13:08, 14 January 2021

Metabolite Cleaved-Angiotensinogen

  • common-name:
    • a cleaved angiotensinogen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality