Difference between revisions of "CPD-13174"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2751 == * common-name: ** 5'-hydroxycotinine * smiles: ** c1(=o)(ccc(o)(n(c)1)c2(=cn=cc=c2)) * inchi-key: ** bbnhnzgtkswihd-snvbaglbs...") |
(Created page with "Category:metabolite == Metabolite CPD-14746 == * common-name: ** thiobenzoate * smiles: ** c(c1(c=cc=cc=1))(s)=o * inchi-key: ** uijgntrupzpvng-uhfffaoysa-n * molecular-we...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-14746 == |
* common-name: | * common-name: | ||
− | ** | + | ** thiobenzoate |
* smiles: | * smiles: | ||
− | ** c1 | + | ** c(c1(c=cc=cc=1))(s)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** uijgntrupzpvng-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 138.184 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13725]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=thiobenzoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uijgntrupzpvng-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=138.184}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-14746
- common-name:
- thiobenzoate
- smiles:
- c(c1(c=cc=cc=1))(s)=o
- inchi-key:
- uijgntrupzpvng-uhfffaoysa-n
- molecular-weight:
- 138.184