Difference between revisions of "5-methylcytosine2870-in-25S-rRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BUTANOL == * common-name: ** butan-1-ol * smiles: ** cccco * inchi-key: ** lrhpldygymqrhn-uhfffaoysa-n * molecular-weight: ** 74.122 == R...")
(Created page with "Category:metabolite == Metabolite CPD-12173 == * common-name: ** (s)-3-hydroxy-isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BUTANOL ==
+
== Metabolite CPD-12173 ==
 
* common-name:
 
* common-name:
** butan-1-ol
+
** (s)-3-hydroxy-isobutanoyl-coa
 
* smiles:
 
* smiles:
** cccco
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
 
* inchi-key:
 
* inchi-key:
** lrhpldygymqrhn-uhfffaoysa-n
+
** wweogfzefhpuam-uqcjfraesa-j
 
* molecular-weight:
 
* molecular-weight:
** 74.122
+
** 849.593
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-161]]
+
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
 +
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BTS_LPAREN_nadph_RPAREN_]]
+
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
* [[RXN-161]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=butan-1-ol}}
+
{{#set: common-name=(s)-3-hydroxy-isobutanoyl-coa}}
{{#set: inchi-key=inchikey=lrhpldygymqrhn-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=wweogfzefhpuam-uqcjfraesa-j}}
{{#set: molecular-weight=74.122}}
+
{{#set: molecular-weight=849.593}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-12173

  • common-name:
    • (s)-3-hydroxy-isobutanoyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
  • inchi-key:
    • wweogfzefhpuam-uqcjfraesa-j
  • molecular-weight:
    • 849.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality