Difference between revisions of "TROPINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SINAPOYL-COA == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(oc...")
(Created page with "Category:metabolite == Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P == * common-name: ** 5-enolpyruvoyl-shikimate 3-phosphate * smiles: ** c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SINAPOYL-COA ==
+
== Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P ==
 
* common-name:
 
* common-name:
** sinapoyl-coa
+
** 5-enolpyruvoyl-shikimate 3-phosphate
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1)
 
* inchi-key:
 
* inchi-key:
** rbfuwesmwrugfy-gsnioflcsa-j
+
** qutykixiudqolk-prjmdxoysa-j
 
* molecular-weight:
 
* molecular-weight:
** 969.7
+
** 320.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1124]]
+
* [[2.5.1.19-RXN]]
 +
* [[CHORISMATE-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10919]]
+
* [[2.5.1.19-RXN]]
* [[RXN-1124]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sinapoyl-coa}}
+
{{#set: common-name=5-enolpyruvoyl-shikimate 3-phosphate}}
{{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}}
+
{{#set: inchi-key=inchikey=qutykixiudqolk-prjmdxoysa-j}}
{{#set: molecular-weight=969.7}}
+
{{#set: molecular-weight=320.149}}

Revision as of 13:08, 14 January 2021

Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P

  • common-name:
    • 5-enolpyruvoyl-shikimate 3-phosphate
  • smiles:
    • c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • qutykixiudqolk-prjmdxoysa-j
  • molecular-weight:
    • 320.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality