Difference between revisions of "Delta5-Delta7-Steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15837 == * common-name: ** β-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=cc=2c)o)c)))c)c)c * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite DIVINYLCHLOROPHYLLIDE-A == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15837 ==
+
== Metabolite DIVINYLCHLOROPHYLLIDE-A ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** β-tocotrienol
+
** 3,8-divinyl chlorophyllide a
* smiles:
 
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=cc=2c)o)c)))c)c)c
 
* inchi-key:
 
** fgykufvnyvmtam-wazjvijmsa-n
 
 
* molecular-weight:
 
* molecular-weight:
** 410.639
+
** 610.951
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-5286]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14919]]
+
* [[RXN-5285]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-tocotrienol}}
+
{{#set: common-name=3,8-divinyl chlorophyllide a}}
{{#set: inchi-key=inchikey=fgykufvnyvmtam-wazjvijmsa-n}}
+
{{#set: molecular-weight=610.951}}
{{#set: molecular-weight=410.639}}
 

Revision as of 13:09, 14 January 2021

Metabolite DIVINYLCHLOROPHYLLIDE-A

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • 3,8-divinyl chlorophyllide a
  • molecular-weight:
    • 610.951

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality