Difference between revisions of "Biotin-L-lysine-in-BCCP-dimers"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10818 == * common-name: ** isopentenyl phosphate * smiles: ** c=c(ccop(=o)([o-])[o-])c * inchi-key: ** qmzrxycccyymhf-uhfffaoysa-l *...") |
(Created page with "Category:metabolite == Metabolite CPD-3705 == * common-name: ** adenosine 2'-monophosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o * in...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-3705 == |
* common-name: | * common-name: | ||
− | ** | + | ** adenosine 2'-monophosphate |
* smiles: | * smiles: | ||
− | ** c=c( | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qdfhpfsbqfllsw-kqynxxcusa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 345.208 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12057]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=adenosine 2'-monophosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qdfhpfsbqfllsw-kqynxxcusa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=345.208}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD-3705
- common-name:
- adenosine 2'-monophosphate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o
- inchi-key:
- qdfhpfsbqfllsw-kqynxxcusa-l
- molecular-weight:
- 345.208