Difference between revisions of "CPD-8163"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Keratan-sulfate-NAcGlcN6S == * common-name: ** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate == Reaction(s) known to consu...") |
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-ACETOL-P == * common-name: ** imidazole acetol-phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o) * inchi-key: ** ycffms...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite IMIDAZOLE-ACETOL-P == |
* common-name: | * common-name: | ||
− | ** [ | + | ** imidazole acetol-phosphate |
+ | * smiles: | ||
+ | ** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o) | ||
+ | * inchi-key: | ||
+ | ** ycffmsolumramd-uhfffaoysa-l | ||
+ | * molecular-weight: | ||
+ | ** 218.105 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[HISTAMINOTRANS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[HISTAMINOTRANS-RXN]] | ||
+ | * [[IGPD]] | ||
+ | * [[IMIDPHOSDEHYD-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=imidazole acetol-phosphate}} |
+ | {{#set: inchi-key=inchikey=ycffmsolumramd-uhfffaoysa-l}} | ||
+ | {{#set: molecular-weight=218.105}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite IMIDAZOLE-ACETOL-P
- common-name:
- imidazole acetol-phosphate
- smiles:
- c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
- inchi-key:
- ycffmsolumramd-uhfffaoysa-l
- molecular-weight:
- 218.105