Difference between revisions of "Phytoceramides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-GLU == * common-name: ** n-acetyl-l-glutamate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** rfmmmvdnipukgg-yfkpbyrvs...")
(Created page with "Category:metabolite == Metabolite METHYLENE-THF-GLU-N == * common-name: ** a 5,10-methylene-tetrahydrofolate == Reaction(s) known to consume the compound == * 1.5.1.15-R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETYL-GLU ==
+
== Metabolite METHYLENE-THF-GLU-N ==
 
* common-name:
 
* common-name:
** n-acetyl-l-glutamate
+
** a 5,10-methylene-tetrahydrofolate
* smiles:
 
** cc(=o)nc(c([o-])=o)ccc(=o)[o-]
 
* inchi-key:
 
** rfmmmvdnipukgg-yfkpbyrvsa-l
 
* molecular-weight:
 
** 187.152
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[1.5.1.15-RXN]]
* [[AGK]]
+
* [[1.5.1.20-RXN]]
* [[N-ACETYLTRANSFER-RXN]]
+
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
 +
* [[GCVT-RXN]]
 +
* [[GLYOHMETRANS-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
* [[RXN0-2921]]
 +
* [[THYMIDYLATESYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+
* [[GCVT-RXN]]
* [[N-ACETYLTRANSFER-RXN]]
+
* [[GLYOHMETRANS-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
* [[RXN0-2921]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-glutamate}}
+
{{#set: common-name=a 5,10-methylene-tetrahydrofolate}}
{{#set: inchi-key=inchikey=rfmmmvdnipukgg-yfkpbyrvsa-l}}
 
{{#set: molecular-weight=187.152}}
 

Revision as of 13:09, 14 January 2021