Difference between revisions of "Core-Protein-L-Ser-Xyl"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-hydroxy-L-proline-HIF-Alpha == * common-name: ** a trans-4-hydroxy-l-proline-hif α subunit == Reaction(s) known to consume the co...") |
(Created page with "Category:metabolite == Metabolite CPD-505 == * common-name: ** d-myo-inositol (1,3,4,6)-tetrakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-505 == |
* common-name: | * common-name: | ||
− | ** | + | ** d-myo-inositol (1,3,4,6)-tetrakisphosphate |
+ | * smiles: | ||
+ | ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) | ||
+ | * inchi-key: | ||
+ | ** zawixngttztbkv-jmvowjsssa-f | ||
+ | * molecular-weight: | ||
+ | ** 492.013 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.7.1.140-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[2.7.1.133-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol (1,3,4,6)-tetrakisphosphate}} |
+ | {{#set: inchi-key=inchikey=zawixngttztbkv-jmvowjsssa-f}} | ||
+ | {{#set: molecular-weight=492.013}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD-505
- common-name:
- d-myo-inositol (1,3,4,6)-tetrakisphosphate
- smiles:
- c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- zawixngttztbkv-jmvowjsssa-f
- molecular-weight:
- 492.013