Difference between revisions of "Charged-TYR-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBULOSE-5P == * common-name: ** d-ribulose 5-phosphate * smiles: ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o * inchi-key: ** fnzlkvnuwiipsj-uh...") |
(Created page with "Category:metabolite == Metabolite CPD-12724 == * common-name: ** baicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3))) * inchi-key: ** fxnfhkrtjbstcs...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-12724 == |
* common-name: | * common-name: | ||
− | ** | + | ** baicalein |
* smiles: | * smiles: | ||
− | ** | + | ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** fxnfhkrtjbstcs-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 270.241 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14240]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=baicalein}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fxnfhkrtjbstcs-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=270.241}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD-12724
- common-name:
- baicalein
- smiles:
- c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3)))
- inchi-key:
- fxnfhkrtjbstcs-uhfffaoysa-n
- molecular-weight:
- 270.241