Difference between revisions of "Gal-Gal-Xyl-Proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15666 == * common-name: ** 2-trans,6-cis-tridecadienoyl-coa * smiles: ** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...") |
(Created page with "Category:metabolite == Metabolite O-SINAPOYLCHOLINE == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c * inchi-key: ** hu...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite O-SINAPOYLCHOLINE == |
* common-name: | * common-name: | ||
− | ** | + | ** o-sinapoylcholine |
* smiles: | * smiles: | ||
− | ** | + | ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hujxhfrxwwgyqh-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 310.369 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[2.3.1.91-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=o-sinapoylcholine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hujxhfrxwwgyqh-uhfffaoysa-o}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=310.369}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite O-SINAPOYLCHOLINE
- common-name:
- o-sinapoylcholine
- smiles:
- c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
- inchi-key:
- hujxhfrxwwgyqh-uhfffaoysa-o
- molecular-weight:
- 310.369