Difference between revisions of "CPD-7014"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XTP == * common-name: ** xtp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi...") |
(Created page with "Category:metabolite == Metabolite 5-L-GLUTAMYL-PEPTIDE == * common-name: ** a 5-l-glutamyl-[peptide] == Reaction(s) known to consume the compound == * GAMMA-GLUTAMYLTRAN...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-L-GLUTAMYL-PEPTIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5-l-glutamyl-[peptide] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GAMMA-GLUTAMYLTRANSFERASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5-l-glutamyl-[peptide]}} |
| − | |||
| − | |||
Revision as of 13:09, 14 January 2021
Contents
Metabolite 5-L-GLUTAMYL-PEPTIDE
- common-name:
- a 5-l-glutamyl-[peptide]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5-l-glutamyl-[peptide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
