Difference between revisions of "TRNAs-with-CCA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Drugs == * common-name: ** a drug == Reaction(s) known to consume the compound == * TRANS-RXN-311 == Reaction(s) known to produce the...") |
(Created page with "Category:metabolite == Metabolite CPD-7025 == * common-name: ** phytyl monophosphate * smiles: ** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c * inchi-key: ** yrxrhzokdfc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7025 == |
* common-name: | * common-name: | ||
− | ** | + | ** phytyl monophosphate |
+ | * smiles: | ||
+ | ** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c | ||
+ | * inchi-key: | ||
+ | ** yrxrhzokdfcxib-pyddkjgssa-l | ||
+ | * molecular-weight: | ||
+ | ** 374.499 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-7683]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=phytyl monophosphate}} |
+ | {{#set: inchi-key=inchikey=yrxrhzokdfcxib-pyddkjgssa-l}} | ||
+ | {{#set: molecular-weight=374.499}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD-7025
- common-name:
- phytyl monophosphate
- smiles:
- cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
- inchi-key:
- yrxrhzokdfcxib-pyddkjgssa-l
- molecular-weight:
- 374.499