Difference between revisions of "1-Alkyl-2-acyl-glycerol"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9451 == * common-name: ** 2-isopropylmaleate * smiles: ** cc(c(c(=o)[o-])=cc(=o)[o-])c * inchi-key: ** njmgrjlqrlfqqx-hyxafxhysa-l *...") |
(Created page with "Category:metabolite == Metabolite RIBOSE-5P == * common-name: ** d-ribose 5-phosphate == Reaction(s) known to consume the compound == * 1TRANSKETO-RXN * PPENTOMUT-RX...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RIBOSE-5P == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-ribose 5-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1TRANSKETO-RXN]] |
| − | * [[ | + | * [[PPENTOMUT-RXN]] |
| − | * [[RXN- | + | * [[PRPPSYN-RXN]] |
| + | * [[RIB5PISOM-RXN]] | ||
| + | * [[RXN-12590]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1TRANSKETO-RXN]] |
| − | * [[ | + | * [[PPENTOMUT-RXN]] |
| − | * [[RXN | + | * [[PRPPSYN-RXN]] |
| + | * [[RIB5PISOM-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-ribose 5-phosphate}} |
| − | |||
| − | |||
Revision as of 13:09, 14 January 2021
Contents
Metabolite RIBOSE-5P
- common-name:
- d-ribose 5-phosphate
