Difference between revisions of "DEOXY-D-RIBOSE-1-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-DEHYDRO-SHIKIMATE == * common-name: ** 3-dehydroshikimate * smiles: ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) * inchi-key: ** slwwjzmphjjoph-...") |
(Created page with "Category:metabolite == Metabolite CPD-19726 == * common-name: ** (4s)-2,3-dehydro-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19726 == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** (4s)-2,3-dehydro-leucocyanidin |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yaagnrwejszflv-zdusscgksa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 304.256 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-602]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=(4s)-2,3-dehydro-leucocyanidin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yaagnrwejszflv-zdusscgksa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=304.256}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-19726
- common-name:
- (4s)-2,3-dehydro-leucocyanidin
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o)
- inchi-key:
- yaagnrwejszflv-zdusscgksa-n
- molecular-weight:
- 304.256
