Difference between revisions of "CPDQT-520"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SPERMIDINE == * common-name: ** spermidine * smiles: ** c([n+])cc[n+]cccc[n+] * inchi-key: ** athghqpfgpmsjy-uhfffaoysa-q * molecular-wei...")
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * smiles: ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SPERMIDINE ==
+
== Metabolite CPD0-2123 ==
 
* common-name:
 
* common-name:
** spermidine
+
** 3-oxodecanoyl-coa
 
* smiles:
 
* smiles:
** c([n+])cc[n+]cccc[n+]
+
** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** athghqpfgpmsjy-uhfffaoysa-q
+
** azcvxmaplhsiky-hsjnekgzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 148.271
+
** 931.738
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.46-RXN]]
+
* [[ACACT4]]
* [[ABC-24-RXN]]
+
* [[HACD4h]]
* [[RXN-11190]]
+
* [[RXN-13617]]
* [[RXN-13414]]
 
* [[SPERMIDINESYN-RXN]]
 
* [[SPERMINE-SYNTHASE-RXN]]
 
* [[SPMDtmi]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ABC-24-RXN]]
+
* [[ACACT4]]
* [[APAPT]]
+
* [[ACACT4h]]
* [[RXN-11190]]
+
* [[HACD4h]]
* [[SPERMIDINESYN-RXN]]
+
* [[RXN-12490]]
* [[SPMDtmi]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=spermidine}}
+
{{#set: common-name=3-oxodecanoyl-coa}}
{{#set: inchi-key=inchikey=athghqpfgpmsjy-uhfffaoysa-q}}
+
{{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}}
{{#set: molecular-weight=148.271}}
+
{{#set: molecular-weight=931.738}}

Revision as of 13:10, 14 January 2021

Metabolite CPD0-2123

  • common-name:
    • 3-oxodecanoyl-coa
  • smiles:
    • cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • azcvxmaplhsiky-hsjnekgzsa-j
  • molecular-weight:
    • 931.738

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality