Difference between revisions of "THR"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Phospholipids == * common-name: ** a phospholipid == Reaction(s) known to consume the compound == * 3.6.3.1-RXN == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite TRYPTAMINE == * common-name: ** tryptamine * smiles: ** c([n+])cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** apjydqyyacxcrm-uhfffaoysa-o * molec...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TRYPTAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** tryptamine |
| + | * smiles: | ||
| + | ** c([n+])cc1(=cnc2(c=cc=cc1=2)) | ||
| + | * inchi-key: | ||
| + | ** apjydqyyacxcrm-uhfffaoysa-o | ||
| + | * molecular-weight: | ||
| + | ** 161.226 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-1401]] |
| + | * [[STRICTOSIDINE-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tryptamine}} |
| + | {{#set: inchi-key=inchikey=apjydqyyacxcrm-uhfffaoysa-o}} | ||
| + | {{#set: molecular-weight=161.226}} | ||
Revision as of 13:10, 14 January 2021
Contents
Metabolite TRYPTAMINE
- common-name:
- tryptamine
- smiles:
- c([n+])cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- apjydqyyacxcrm-uhfffaoysa-o
- molecular-weight:
- 161.226
