Difference between revisions of "BENZOYLCOA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9871 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite PREGNENOLONE == * common-name: ** pregnenolone * smiles: ** cc(=o)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9871 ==
+
== Metabolite PREGNENOLONE ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
+
** pregnenolone
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
+
** cc(=o)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** xcoxsblqzpfvgk-rgiwonjesa-n
+
** ornbqbciokfoeo-qgvnflhtsa-n
 
* molecular-weight:
 
* molecular-weight:
** 835.347
+
** 316.483
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-353]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9235]]
+
* [[RXN66-353]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=pregnenolone}}
{{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}}
+
{{#set: inchi-key=inchikey=ornbqbciokfoeo-qgvnflhtsa-n}}
{{#set: molecular-weight=835.347}}
+
{{#set: molecular-weight=316.483}}

Revision as of 13:10, 14 January 2021

Metabolite PREGNENOLONE

  • common-name:
    • pregnenolone
  • smiles:
    • cc(=o)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • ornbqbciokfoeo-qgvnflhtsa-n
  • molecular-weight:
    • 316.483

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality