Difference between revisions of "Charged-GLT-tRNAs"

Revision as of 13:10, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite OH-HEXANOYL-COA ==
+== Metabolite VAL ==
 * common-name:
-** (s)-3-hydroxyhexanoyl-coa
+** l-valine
 * smiles:
-** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
+** cc(c)c([n+])c([o-])=o
 * inchi-key:
-** vaahkrmgofiorx-dwufxmdisa-j
+** kzsnjwfqevhdmf-bypyzucnsa-n
 * molecular-weight:
-** 877.646
+** 117.147
 == Reaction(s) known to consume the compound ==
-* [[ECOAH2h]]
+* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
-* [[HACD2h]]
+* [[RXN-16291]]
-* [[RXN-12567]]
+* [[RXN-16294]]
+* [[RXN-16991]]
+* [[VALINE--TRNA-LIGASE-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[ECOAH2h]]
+* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
-* [[HACD2h]]
+* [[RXN-16294]]
-* [[RXN-12570]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-3-hydroxyhexanoyl-coa}}
+{{#set: common-name=l-valine}}
-{{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}}
+{{#set: inchi-key=inchikey=kzsnjwfqevhdmf-bypyzucnsa-n}}
-{{#set: molecular-weight=877.646}}
+{{#set: molecular-weight=117.147}}