Difference between revisions of "CPD-321"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-29 == * common-name: ** 5-androstene-3,17-dione * smiles: ** cc24(ccc(=o)cc(=cc[ch]1([ch]3(ccc(=o)c(cc[ch]12)(c)3)))4) * inchi-key:...")
(Created page with "Category:metabolite == Metabolite CPD-9897 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD66-29 ==
+
== Metabolite CPD-9897 ==
 
* common-name:
 
* common-name:
** 5-androstene-3,17-dione
+
** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate
 
* smiles:
 
* smiles:
** cc24(ccc(=o)cc(=cc[ch]1([ch]3(ccc(=o)c(cc[ch]12)(c)3)))4)
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** sqgzfritsmykrh-qaggrknesa-n
+
** wcqcnoikxgndlx-rdsvhmiisa-m
 
* molecular-weight:
 
* molecular-weight:
** 286.413
+
** 848.323
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-342]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-342]]
+
* [[RXN-9282]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-androstene-3,17-dione}}
+
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate}}
{{#set: inchi-key=inchikey=sqgzfritsmykrh-qaggrknesa-n}}
+
{{#set: inchi-key=inchikey=wcqcnoikxgndlx-rdsvhmiisa-m}}
{{#set: molecular-weight=286.413}}
+
{{#set: molecular-weight=848.323}}

Revision as of 13:11, 14 January 2021

Metabolite CPD-9897

  • common-name:
    • 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • wcqcnoikxgndlx-rdsvhmiisa-m
  • molecular-weight:
    • 848.323

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality