Difference between revisions of "DEHYDRO-DEOXY-GALACTONATE-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7032 == * common-name: ** 3-methylbutanol * smiles: ** cc(cco)c * inchi-key: ** phtqwckdnzkarw-uhfffaoysa-n * molecular-weight: ** 88...") |
(Created page with "Category:metabolite == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == * common-name: ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c(nc=o)c(=o)nc1(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide |
* smiles: | * smiles: | ||
− | ** | + | ** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vdxlundmvkskho-xvfcmesisa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 312.172 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[FGAMSYN-RXN]] |
+ | * [[FGFTh]] | ||
+ | * [[FPGFTh]] | ||
+ | * [[GART-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[FPGFTh]] |
+ | * [[GART-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=312.172}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE
- common-name:
- n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
- smiles:
- c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
- inchi-key:
- vdxlundmvkskho-xvfcmesisa-l
- molecular-weight:
- 312.172