Difference between revisions of "UROPORPHYRINOGEN-III"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14443 == * common-name: ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o) * inchi-k...") |
(Created page with "Category:metabolite == Metabolite Thiopurines == * common-name: ** a thiopurine == Reaction(s) known to consume the compound == * THIOPURINE-S-METHYLTRANSFERASE-RXN ==...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Thiopurines == |
* common-name: | * common-name: | ||
− | ** | + | ** a thiopurine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[THIOPURINE-S-METHYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a thiopurine}} |
− | |||
− |
Revision as of 13:11, 14 January 2021
Contents
Metabolite Thiopurines
- common-name:
- a thiopurine